| Catalog |
ACM100061 |
| CAS |
100-06-1 |
| Structure |  |
| Description |
Solid;colourless to pale yellow fused solid with a floral, powdery, vanillic, balsamic odour |
| Synonyms |
Epenone |
| IUPAC Name |
1-(4-Methoxyphenyl)ethanone |
| Molecular Weight |
150.17 |
| Molecular Formula |
C9H10O2 |
| Canonical SMILES |
CC(=O)C1=CC=C(C=C1)OC |
| InChI |
InChI=1S/C9H10O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-6H,1-2H3 |
| InChI Key |
NTPLXRHDUXRPNE-UHFFFAOYSA-N |
| Boiling Point |
152-154 °C/26 mmHg(lit.) |
| Melting Point |
36-38 °C(lit.) |
| Flash Point |
>230 °F |
| Purity |
99% |
| Density |
1.08 g/cm³ |
| Solubility |
Insoluble in water |
| Appearance |
Solid |
| Application |
4'-Methoxyacetophenone, a compound that can be derived from anise oil, is known for its distinctive sweet aroma reminiscent of hawthorn. It typically appears as white crystals with a melting point of 38°C. The compound is synthesized through a Friedel-Crafts acetylation of anisole, with modern methods utilizing ??-zeolites as catalysts in continuous flow processes. Its primary purpose lies in its application in the fragrance and flavor industries. In perfumery, it is valued for its contribution to floral scents, making it a popular choice in soap and perfume formulations. Additionally, 4'-Methoxyacetophenone is used to impart flavors in various products, including alcohol, baked goods, chewing gum, dairy items, gelatins, and candies, with specific concentrations recommended for specific food categories to ensure optimal taste and aroma. |
| Storage |
Keep in dark place, sealed in dry, room temperature |
| Exact Mass |
150.068079557 |
| Monoisotopic Mass |
150.068079557 |
| Odor |
Floral, powdery, vanillic, balsamic odor |
| Physical State |
Crystals or crystalline powder |
| Refractive Index |
1.5470 |
| Storage Conditions |
Dark and dry place,Room Temperature |
| Topological Polar Surface Area |
26.3 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
