| Catalog |
ACM123251-2 |
| CAS |
123-25-1 |
| Structure |  |
| Description |
It is the diethyl ester of succinate. |
| Synonyms |
Clorius |
| IUPAC Name |
Diethyl butanedioate |
| Molecular Weight |
174.19 |
| Molecular Formula |
C8H14O4 |
| Canonical SMILES |
CCOC(=O)CCC(=O)OCC |
| InChI |
InChI=1S/C8H14O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-6H2,1-2H3 |
| InChI Key |
DKMROQRQHGEIOW-UHFFFAOYSA-N |
| Boiling Point |
218 °C(lit.) |
| Melting Point |
-20 °C(lit.) |
| Flash Point |
195 °F |
| Purity |
99% |
| Density |
1.047 g/mL at 25 °C(lit.) |
| Solubility |
Slightly soluble in water |
| Appearance |
Clear colorless to yellow liquid |
| Application |
This product is suitable for scientific research. |
| Storage |
Store below +30 °C |
| Exact Mass |
174.08920892 |
| Monoisotopic Mass |
174.08920892 |
| Physical State |
Liquid |
| Refractive Index |
n20/D 1.42(lit.) |
| Storage Conditions |
Below +30 °C |
| Topological Polar Surface Area |
52.6 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
