| Catalog |
ACM617356 |
| CAS |
617-35-6 |
| Structure |  |
| Description |
ethyl pyruvate (EP) has demonstrated neuroprotective effects against acute brain injury through its anti-inflammatory action. |
| Synonyms |
2-Oxopropionic acid ethyl |
| IUPAC Name |
Ethyl 2-oxopropanoate |
| Molecular Weight |
116.12 |
| Molecular Formula |
C5H8O3 |
| Canonical SMILES |
CCOC(=O)C(=O)C |
| InChI |
InChI=1S/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3 |
| InChI Key |
XXRCUYVCPSWGCC-UHFFFAOYSA-N |
| Boiling Point |
144 °C(lit.) |
| Melting Point |
-58 °C |
| Flash Point |
114 °F |
| Purity |
98% |
| Density |
1.045 g/mL at 25 °C(lit.) |
| Solubility |
Miscible with water, ethanol and ether |
| Appearance |
Clear pale yellow liquid |
| Storage |
2-8 °C |
| Exact Mass |
116.047344113 |
| Monoisotopic Mass |
116.047344113 |
| Physical State |
Liquid |
| Refractive Index |
n20/D 1.404(lit.) |
| Storage Conditions |
Dry place |
| Topological Polar Surface Area |
43.4 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
