| Catalog |
ACM67470-2 |
| CAS |
67-47-0 |
| Structure |  |
| Description |
5-Hydroxymethylfurfural (2-Hydroxymethyl-5-furfural), derived from Cornus officinalis, inhibits yeast growth and fermentation as stressors. |
| Synonyms |
5-Hydroxymethyl-2-fluraldehyde |
| IUPAC Name |
5-(Hydroxymethyl)furan-2-carbaldehyde |
| Molecular Weight |
126.11 |
| Molecular Formula |
C6H6O3 |
| Canonical SMILES |
C1=C(OC(=C1)C=O)CO |
| InChI |
InChI=1S/C6H6O3/c7-3-5-1-2-6(4-8)9-5/h1-3,8H,4H2 |
| InChI Key |
NOEGNKMFWQHSLB-UHFFFAOYSA-N |
| Boiling Point |
114-116 °C /1mmHg |
| Melting Point |
28-34 °C |
| Flash Point |
175 °F |
| Purity |
99% |
| Density |
1.243 g/ml |
| Solubility |
Soluble in water, alcohol, ethyl acetate, acetone, dimethylformamide, benzene, ether and chloroform |
| Appearance |
<30°C Solid,>34°C Liquid |
| Storage |
Pure form-20°C, 3 years; In solvent-80°C, 6 months; -20°C, 1 month. |
| Exact Mass |
126.031694049 |
| Monoisotopic Mass |
126.031694049 |
| Physical State |
Liquid or crystalline powder |
| Refractive Index |
n20/D 1.562(lit.) |
| Storage Conditions |
2-8 °C |
| Topological Polar Surface Area |
50.4 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
