| Catalog |
ACM112618-1 |
| CAS |
112-61-8 |
| Structure |  |
| Description |
off-white to cream or light yellow paste;Methyl stearate is used as a nonionic surfactant in various experiments in helping solubilize a variety of chemical species by dissociating aggregates and unfolding proteins. |
| Synonyms |
Methyl ester stearic acid |
| IUPAC Name |
Methyl octadecanoate |
| Molecular Weight |
298.5 |
| Molecular Formula |
C19H38O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCCCC(=O)OC |
| InChI |
InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| InChI Key |
HPEUJPJOZXNMSJ-UHFFFAOYSA-N |
| Boiling Point |
215 °C |
| Melting Point |
37-41 °C(lit.) |
| Flash Point |
>230 °F |
| Purity |
95%+ |
| Density |
0.84 g/cm³ |
| Solubility |
Soluble in chloroform, insoluble in water |
| Appearance |
Solid |
| Storage |
-20 °C |
| Exact Mass |
298.287180451 |
| Monoisotopic Mass |
298.287180451 |
| Physical State |
Crystals |
| Refractive Index |
1.4241 |
| Storage Conditions |
-20 °C |
| Topological Polar Surface Area |
26.3 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
