| Catalog |
ACM57103-2 |
| CAS |
57-10-3 |
| Structure |  |
| Description |
Emulsifying fatty acid derived from palm oil. Saponification value 218-222. HLB 11-12 (gives oil-in-water emulsions). |
| Synonyms |
Pentadecanecarboxylicacid |
| IUPAC Name |
Hexadecanoic acid |
| Molecular Weight |
256.42 |
| Molecular Formula |
C16H32O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| InChI Key |
IPCSVZSSVZVIGE-UHFFFAOYSA-N |
| Boiling Point |
351.5 °C |
| Melting Point |
61-62.5 °C(lit.) |
| Flash Point |
>230 °F |
| Purity |
95% |
| Density |
0.852 g/mL at 25 °C(lit.) |
| Solubility |
Soluble in hot alcohol, ether |
| Appearance |
Solid |
| Application |
Creams, cream rinses, shampoos and conditioners, soaps, and many other basic cosmetic preparations. |
| Storage |
Room temperature |
| Exact Mass |
256.240230259 |
| Monoisotopic Mass |
256.240230259 |
| Odor |
Virtually odorless; slight characteristic odor |
| Physical State |
Flakes |
| Refractive Index |
1.4273 |
| Storage Conditions |
Room Temperature |
| Topological Polar Surface Area |
37.3 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
