2,3-Pyrazinedicarboxylic Acid

Catalog	ACM89010
CAS	89-01-0
Structure
Synonyms	3-Pyrazinedicarboxylic acid
IUPAC Name	Pyrazine-2,3-dicarboxylic acid
Molecular Weight	168.11
Molecular Formula	C6H4N2O4
Canonical SMILES	C1=CN=C(C(=N1)C(=O)O)C(=O)O
InChI	InChI=1S/C6H4N2O4/c9-5(10)3-4(6(11)12)8-2-1-7-3/h1-2H,(H,9,10)(H,11,12)
InChI Key	ZUCRGHABDDWQPY-UHFFFAOYSA-N
Boiling Point	297.01 °C
Melting Point	188 °C
Purity	95%+
Density	1.6328 g/mL at 25 °C(lit.)
Appearance	White to Almost white powder to crystal
Application	2,3-Pyrazinedicarboxylic Acid serves multiple purposes, primarily recognized for its antifungal and antibacterial properties. It plays a crucial role as a reagent in the synthesis of transition metal pyrazinedicarboxylate complexes. The compound's anionic form has garnered significant interest in both coordination and supra-molecular chemistry due to its tendency to react with metal salts, producing insoluble polynuclear materials. This property extends its applications to crystal engineering, particularly in forming complexes with creatinine and 2-amino-4-hydroxy-6-methylpyrimidine. As a dicarboxylate ligand, 2,3-Pyrazinedicarboxylic Acid can link neighboring metal atoms to create one-dimensional chains in various complexes. Additionally, it demonstrates versatility by coordinating with neodymium(III) atoms in multiple bonding modes. When combined with neodymium nitrate, it facilitates the synthesis of coordination polymers with intricate three-dimensional frameworks through hydrothermal methods.
Storage	Store under inert gas
Exact Mass	168.01710661
Monoisotopic Mass	168.01710661
Physical State	Crystalline
Refractive Index	n20/D 1.4738(lit.)
Storage Conditions	Dry place,Room Temperature
Topological Polar Surface Area	100 Ų