| Catalog |
ACM143077-2 |
| CAS |
143-07-7 |
| Structure |  |
| Description |
Lauric acid is a white solid with a slight odor of bay oil. (USCG, 1999);DryPowder; Liquid; OtherSolid; OtherSolid, Liquid;Liquid;Solid;white or faintly yellowish crystalline solid |
| Synonyms |
Dodecylicacid |
| IUPAC Name |
Dodecanoic acid |
| Molecular Weight |
200.32 |
| Molecular Formula |
C12H24O2 |
| Canonical SMILES |
CCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
| InChI Key |
POULHZVOKOAJMA-UHFFFAOYSA-N |
| Boiling Point |
225 °C/100 mmHg(lit.) |
| Melting Point |
44-46 °C(lit.) |
| Flash Point |
>230 °F |
| Purity |
99% |
| Density |
0.883 g/mL at 25 °C(lit.) |
| Solubility |
Practically insoluble in water, soluble in alcohol, chloroform, ether |
| Appearance |
Solid |
| Storage |
2-8 °C |
| Exact Mass |
200.177630004 |
| Monoisotopic Mass |
200.177630004 |
| Odor |
Characteristic, like oil of bay |
| Physical State |
Crystalline powder of flakes |
| Refractive Index |
1.4304 |
| Storage Conditions |
2-8 °C |
| Topological Polar Surface Area |
37.3 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
