| Catalog |
ACM127173 |
| CAS |
127-17-3 |
| Structure |  |
| Description |
Pyruvic acid (CH3COCOOH) is the simplest of the alpha-keto acids, with a carboxylic acid and a ketone functional group. Pyruvate, the conjugate base, CH3COCOO−, is an intermediate in several metabolic pathways throughout the cell.; |
| Synonyms |
α-Ketopropionic acid |
| IUPAC Name |
2-Oxopropanoic acid |
| Molecular Weight |
88.06 |
| Molecular Formula |
C3H4O3 |
| Canonical SMILES |
CC(=O)C(=O)O |
| InChI |
InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6) |
| InChI Key |
LCTONWCANYUPML-UHFFFAOYSA-N |
| Boiling Point |
165 °C(lit.) |
| Melting Point |
11-12 °C(lit.) |
| Flash Point |
183 °F |
| Purity |
99% |
| Density |
1.267 g/mL at 25 °C(lit.) |
| Solubility |
Miscible with chloroform and methanol |
| Appearance |
Liquid |
| Storage |
2-8 °C |
| Exact Mass |
88.016043985 |
| Monoisotopic Mass |
88.016043985 |
| Physical State |
Liquid |
| Refractive Index |
n20/D 1.428(lit.) |
| Storage Conditions |
2-8 °C |
| Topological Polar Surface Area |
54.4 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
